C11H15ClO4 — CID 162420230
[(1R,3R,6S)-3-acetyloxy-6-chlorocyclohept-4-en-1-yl] acetate (PubChem CID 162420230) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is [(1R,3R,6S)-3-acetyloxy-6-chlorocyclohept-4-en-1-yl] acetate.
| Compound Name | [(1R,3R,6S)-3-acetyloxy-6-chlorocyclohept-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 162420230 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(1R,3R,6S)-3-acetyloxy-6-chlorocyclohept-4-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](Cl)C=C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C11H15ClO4/c1-7(13)15-10-4-3-9(12)5-11(6-10)16-8(2)14/h3-4,9-11H,5-6H2,1-2H3/t9-,10+,11+/m1/s1 |
| InChIKey | ZBCXCQFOQXNMFG-VWYCJHECSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|