About [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate
[(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate (PubChem CID 162420339) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate |
| PubChem CID | 162420339 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC(C)=C1C |
| InChI | InChI=1S/C9H14O2/c1-6-4-5-9(7(6)2)11-8(3)10/h9H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | SRKUBAOZYDBZLD-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate?
The IUPAC name of [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate (CID 162420339) is [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate.
What is the SMILES notation for [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate?
The canonical SMILES for [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate is CC(=O)O[C@H]1CCC(C)=C1C.
What is the InChIKey of [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate?
The InChIKey is SRKUBAOZYDBZLD-VIFPVBQESA-N. The full InChI is InChI=1S/C9H14O2/c1-6-4-5-9(7(6)2)11-8(3)10/h9H,4-5H2,1-3H3/t9-/m0/s1.
What are the key properties of [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate?
[(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate has a molecular weight of 154.21 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,3-dimethylcyclopent-2-en-1-yl] acetate is sourced from PubChem (CID 162420339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).