About 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide
6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide (PubChem CID 162420999) has the molecular formula C8H7FN4O
and a molecular weight of 194.17 g/mol. Its IUPAC name is 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide |
| PubChem CID | 162420999 |
| Molecular Formula | C8H7FN4O |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1cnc2ccc(F)cn12 |
| InChI | InChI=1S/C8H7FN4O/c9-5-1-2-7-11-3-6(8(14)12-10)13(7)4-5/h1-4H,10H2,(H,12,14) |
| InChIKey | GJLVDPYWODHQOS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide?
The IUPAC name of 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide (CID 162420999) is 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide.
What is the SMILES notation for 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide?
The canonical SMILES for 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide is NNC(=O)c1cnc2ccc(F)cn12.
What is the InChIKey of 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide?
The InChIKey is GJLVDPYWODHQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN4O/c9-5-1-2-7-11-3-6(8(14)12-10)13(7)4-5/h1-4H,10H2,(H,12,14).
What are the key properties of 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide?
6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide has a molecular weight of 194.17 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoroimidazo[1,2-a]pyridine-3-carbohydrazide is sourced from PubChem (CID 162420999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).