About ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate
ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 162422182) has the molecular formula C9H10F2N2O3
and a molecular weight of 232.19 g/mol. Its IUPAC name is ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate |
| PubChem CID | 162422182 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(C)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H10F2N2O3/c1-3-16-7(15)5-4-12-8(9(2,10)11)13-6(5)14/h4H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | MPHTXCCYJWFRFS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate (CID 162422182) is ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate is CCOC(=O)c1cnc(C(C)(F)F)[nH]c1=O.
What is the InChIKey of ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate?
The InChIKey is MPHTXCCYJWFRFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O3/c1-3-16-7(15)5-4-12-8(9(2,10)11)13-6(5)14/h4H,3H2,1-2H3,(H,12,13,14).
What are the key properties of ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate?
ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate has a molecular weight of 232.19 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,1-difluoroethyl)-6-oxo-1H-pyrimidine-5-carboxylate is sourced from PubChem (CID 162422182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).