About (R)-5-methyl-tetronate
(R)-5-methyl-tetronate (PubChem CID 162422389) has the molecular formula C5H5O3-
and a molecular weight of 113.09 g/mol. Its IUPAC name is (2R)-2-methyl-5-oxo-2H-furan-3-olate.
Molecular Properties
| Compound Name | (R)-5-methyl-tetronate |
| PubChem CID | 162422389 |
| Molecular Formula | C5H5O3- |
| Molecular Weight | 113.09 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | (2R)-2-methyl-5-oxo-2H-furan-3-olate |
| SMILES | C[C@@H]1C(=CC(=O)O1)[O-] |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h2-3,6H,1H3/p-1/t3-/m1/s1 |
| InChIKey | JGAAAWQBYJNOIW-GSVOUGTGSA-M |
| XLogP | 0.60 |
| TPSA | 49.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 148 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.09 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-5-methyl-tetronate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-5-methyl-tetronate?
The IUPAC name of (R)-5-methyl-tetronate (CID 162422389) is (2R)-2-methyl-5-oxo-2H-furan-3-olate.
What is the SMILES notation for (R)-5-methyl-tetronate?
The canonical SMILES for (R)-5-methyl-tetronate is C[C@@H]1C(=CC(=O)O1)[O-].
What is the InChIKey of (R)-5-methyl-tetronate?
The InChIKey is JGAAAWQBYJNOIW-GSVOUGTGSA-M. The full InChI is InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h2-3,6H,1H3/p-1/t3-/m1/s1.
What are the key properties of (R)-5-methyl-tetronate?
(R)-5-methyl-tetronate has a molecular weight of 113.09 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-5-methyl-tetronate is sourced from PubChem (CID 162422389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).