2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride

C7H13ClN2O2 — CID 162422469

IUPAC2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride
SMILESCl.O=C(O)C12CCC(CN1)NC2
InChIInChI=1S/C7H12N2O2.ClH/c10-6(11)7-2-1-5(3-9-7)8-4-7;/h5,8-9H,1-4H2,(H,10,11);1H
InChIKeyIYKJHBHKQAVVJT-UHFFFAOYSA-N
MW192.65 g/mol
LogP-0.41
Rot. Bonds1

About 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride

2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride (PubChem CID 162422469) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride.

Molecular Properties

Compound Name2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride
PubChem CID162422469
Molecular FormulaC7H13ClN2O2
Molecular Weight192.65 g/mol
Exact Mass192.07
IUPAC Name2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride
SMILESCl.O=C(O)C12CCC(CN1)NC2
InChIInChI=1S/C7H12N2O2.ClH/c10-6(11)7-2-1-5(3-9-7)8-4-7;/h5,8-9H,1-4H2,(H,10,11);1H
InChIKeyIYKJHBHKQAVVJT-UHFFFAOYSA-N
XLogP-0.41
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.65
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride?
The IUPAC name of 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride (CID 162422469) is 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride.
What is the SMILES notation for 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride?
The canonical SMILES for 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride is Cl.O=C(O)C12CCC(CN1)NC2.
What is the InChIKey of 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride?
The InChIKey is IYKJHBHKQAVVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2.ClH/c10-6(11)7-2-1-5(3-9-7)8-4-7;/h5,8-9H,1-4H2,(H,10,11);1H.
What are the key properties of 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride?
2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride has a molecular weight of 192.65 g/mol, XLogP of -0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 162422469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).