About 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine
2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine (PubChem CID 162422503) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine |
| PubChem CID | 162422503 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine |
| SMILES | FC1(F)CNCc2ccccc2O1 |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)6-12-5-7-3-1-2-4-8(7)13-9/h1-4,12H,5-6H2 |
| InChIKey | BDXCMRXDXBDHOM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine?
The IUPAC name of 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine (CID 162422503) is 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine.
What is the SMILES notation for 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine?
The canonical SMILES for 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine is FC1(F)CNCc2ccccc2O1.
What is the InChIKey of 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine?
The InChIKey is BDXCMRXDXBDHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-9(11)6-12-5-7-3-1-2-4-8(7)13-9/h1-4,12H,5-6H2.
What are the key properties of 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine?
2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine has a molecular weight of 185.17 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-4,5-dihydro-3H-1,4-benzoxazepine is sourced from PubChem (CID 162422503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).