C8H12F2O2 — CID 162422509
(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanol (PubChem CID 162422509) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is (2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanol.
| Compound Name | (2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanol |
|---|---|
| PubChem CID | 162422509 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanol |
| SMILES | OCC1CC2(CO1)CC(F)(F)C2 |
| InChI | InChI=1S/C8H12F2O2/c9-8(10)3-7(4-8)1-6(2-11)12-5-7/h6,11H,1-5H2 |
| InChIKey | UKPXLZCUSXQUPD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |