About 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride
4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 162422604) has the molecular formula C10H13BrClN
and a molecular weight of 262.58 g/mol. Its IUPAC name is 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| PubChem CID | 162422604 |
| Molecular Formula | C10H13BrClN |
| Molecular Weight | 262.58 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | Cc1ccc(Br)c2c1C(N)CC2.Cl |
| InChI | InChI=1S/C10H12BrN.ClH/c1-6-2-4-8(11)7-3-5-9(12)10(6)7;/h2,4,9H,3,5,12H2,1H3;1H |
| InChIKey | KDTROMHWTHNEAL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The IUPAC name of 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CID 162422604) is 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
What is the SMILES notation for 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The canonical SMILES for 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride is Cc1ccc(Br)c2c1C(N)CC2.Cl.
What is the InChIKey of 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The InChIKey is KDTROMHWTHNEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN.ClH/c1-6-2-4-8(11)7-3-5-9(12)10(6)7;/h2,4,9H,3,5,12H2,1H3;1H.
What are the key properties of 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride has a molecular weight of 262.58 g/mol, XLogP of 3.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride is sourced from PubChem (CID 162422604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).