C8H11ClF3N3 — CID 162423020
1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine;hydrochloride (PubChem CID 162423020) has the molecular formula C8H11ClF3N3 and a molecular weight of 241.64 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine;hydrochloride.
| Compound Name | 1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 162423020 |
| Molecular Formula | C8H11ClF3N3 |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine;hydrochloride |
| SMILES | Cl.FC(F)(F)Cn1ncc2c1CCNC2 |
| InChI | InChI=1S/C8H10F3N3.ClH/c9-8(10,11)5-14-7-1-2-12-3-6(7)4-13-14;/h4,12H,1-3,5H2;1H |
| InChIKey | SYHGJLFHXGGDNP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |