C29H36F3N5O3Si — CID 162423528
cis-(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol (PubChem CID 162423528) has the molecular formula C29H36F3N5O3Si and a molecular weight of 587.72 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 162423528 |
| Molecular Formula | C29H36F3N5O3Si |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | cis-(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentan-1-ol |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3nc(N[C@H]4CCC[C@H]4O)ncc3C(F)(F)F)cn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C29H36F3N5O3Si/c1-17-26(18(2)40-36-17)19-9-10-20-21(15-37(24(20)13-19)16-39-11-12-41(3,4)5)27-22(29(30,31)32)14-33-28(35-27)34-23-7-6-8-25(23)38/h9-10,13-15,23,25,38H,6-8,11-12,16H2,1-5H3,(H,33,34,35)/t23-,25+/m0/s1 |
| InChIKey | DYWHRRVUMGRTMY-UKILVPOCSA-N |
| XLogP | 7.03 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|