C42H26S — CID 162423723
2-naphthalen-1-yl-6-(2,3,6-trideuterio-10-phenylanthracen-9-yl)dibenzothiophene (PubChem CID 162423723) has the molecular formula C42H26S and a molecular weight of 565.76 g/mol. Its IUPAC name is 2-naphthalen-1-yl-6-(2,3,6-trideuterio-10-phenylanthracen-9-yl)dibenzothiophene.
| Compound Name | 2-naphthalen-1-yl-6-(2,3,6-trideuterio-10-phenylanthracen-9-yl)dibenzothiophene |
|---|---|
| PubChem CID | 162423723 |
| Molecular Formula | C42H26S |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-naphthalen-1-yl-6-(2,3,6-trideuterio-10-phenylanthracen-9-yl)dibenzothiophene |
| SMILES | [2H]c1ccc2c(-c3cccc4c3sc3ccc(-c5cccc6ccccc56)cc34)c3cc([2H])c([2H])cc3c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C42H26S/c1-2-13-28(14-3-1)40-32-17-6-8-19-34(32)41(35-20-9-7-18-33(35)40)37-23-11-22-36-38-26-29(24-25-39(38)43-42(36)37)31-21-10-15-27-12-4-5-16-30(27)31/h1-26H/i6D,7D,8D |
| InChIKey | HNCKMKVPHSYEQB-AYBVGXBASA-N |
| XLogP | 12.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|