C16H25NO — CID 162423996
6,7-ditert-butyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 162423996) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 6,7-ditert-butyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6,7-ditert-butyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 162423996 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 6,7-ditert-butyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC(C)(C)c1cc2c(cc1C(C)(C)C)OCCN2 |
| InChI | InChI=1S/C16H25NO/c1-15(2,3)11-9-13-14(18-8-7-17-13)10-12(11)16(4,5)6/h9-10,17H,7-8H2,1-6H3 |
| InChIKey | VDJGGUDCLFEFPX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |