C12H19F5O3Si — CID 162424553
[1,1,1,2-tetrafluoro-4-[(3-hydroxy-3-methylpent-4-ynoxy)-dimethylsilyl]butan-2-yl] hypofluorite (PubChem CID 162424553) has the molecular formula C12H19F5O3Si and a molecular weight of 334.36 g/mol. Its IUPAC name is [1,1,1,2-tetrafluoro-4-[(3-hydroxy-3-methylpent-4-ynoxy)-dimethylsilyl]butan-2-yl] hypofluorite.
| Compound Name | [1,1,1,2-tetrafluoro-4-[(3-hydroxy-3-methylpent-4-ynoxy)-dimethylsilyl]butan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 162424553 |
| Molecular Formula | C12H19F5O3Si |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [1,1,1,2-tetrafluoro-4-[(3-hydroxy-3-methylpent-4-ynoxy)-dimethylsilyl]butan-2-yl] hypofluorite |
| SMILES | C#CC(C)(O)CCO[Si](C)(C)CCC(F)(OF)C(F)(F)F |
| InChI | InChI=1S/C12H19F5O3Si/c1-5-10(2,18)6-8-19-21(3,4)9-7-11(13,20-17)12(14,15)16/h1,18H,6-9H2,2-4H3 |
| InChIKey | PRXCYESPJJNBLR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|