C23H19F4N5O3S — CID 162424710
2,2,2-trifluoroethyl 2-[5-fluoro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (PubChem CID 162424710) has the molecular formula C23H19F4N5O3S and a molecular weight of 521.50 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[5-fluoro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-[5-fluoro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 162424710 |
| Molecular Formula | C23H19F4N5O3S |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[5-fluoro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| SMILES | O=C1NCCc2cc(Nc3nc(-c4cc5c(s4)CCN(C(=O)OCC(F)(F)F)C5)ncc3F)ccc21 |
| InChI | InChI=1S/C23H19F4N5O3S/c24-16-9-29-20(31-19(16)30-14-1-2-15-12(7-14)3-5-28-21(15)33)18-8-13-10-32(6-4-17(13)36-18)22(34)35-11-23(25,26)27/h1-2,7-9H,3-6,10-11H2,(H,28,33)(H,29,30,31) |
| InChIKey | BFTXUQPPHHFWDT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |