C45H29N5 — CID 162424757
12-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[3,2-c]carbazole (PubChem CID 162424757) has the molecular formula C45H29N5 and a molecular weight of 644.79 g/mol. Its IUPAC name is 12-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[3,2-c]carbazole.
| Compound Name | 12-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 162424757 |
| Molecular Formula | C45H29N5 |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 12-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3ccc4c(c5ccccc5n4-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C45H29N5/c1-4-14-30(15-5-1)31-24-26-33(27-25-31)44-46-43(32-16-6-2-7-17-32)47-45(48-44)50-39-23-13-11-21-37(39)41-40(50)29-28-36-35-20-10-12-22-38(35)49(42(36)41)34-18-8-3-9-19-34/h1-29H/i3D,8D,9D,18D,19D |
| InChIKey | LRWYAKFLEGZZKM-IAJSEMNZSA-N |
| XLogP | 11.07 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |