C45H27N5O — CID 162424907
12-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 162424907) has the molecular formula C45H27N5O and a molecular weight of 658.78 g/mol. Its IUPAC name is 12-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 162424907 |
| Molecular Formula | C45H27N5O |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | 12-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc4oc5ccccc5c34)nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H27N5O/c1-3-14-28(15-4-1)43-46-44(35-21-13-25-39-40(35)34-20-9-12-24-38(34)51-39)48-45(47-43)50-37-23-11-8-19-31(37)33-27-26-32-30-18-7-10-22-36(30)49(41(32)42(33)50)29-16-5-2-6-17-29/h1-27H/i1D,3D,4D,14D,15D |
| InChIKey | WGPRQPRLCHEBCL-PHQJSJDESA-N |
| XLogP | 11.30 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |