C48H33N5 — CID 162425093
12-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-(9,9-dimethylfluoren-1-yl)indolo[2,3-a]carbazole (PubChem CID 162425093) has the molecular formula C48H33N5 and a molecular weight of 689.89 g/mol. Its IUPAC name is 12-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-(9,9-dimethylfluoren-1-yl)indolo[2,3-a]carbazole.
| Compound Name | 12-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-(9,9-dimethylfluoren-1-yl)indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 162425093 |
| Molecular Formula | C48H33N5 |
| Molecular Weight | 689.89 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | 12-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-11-(9,9-dimethylfluoren-1-yl)indolo[2,3-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6cccc7c6C(C)(C)c6ccccc6-7)c5c43)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H33N5/c1-48(2)38-24-12-9-20-32(38)35-23-15-27-41(42(35)48)52-39-25-13-10-21-33(39)36-28-29-37-34-22-11-14-26-40(34)53(44(37)43(36)52)47-50-45(30-16-5-3-6-17-30)49-46(51-47)31-18-7-4-8-19-31/h3-29H,1-2H3/i3D,4D,5D,6D,7D,8D,16D,17D,18D,19D |
| InChIKey | KFRAMCSJQDYYQN-XABCHSOKSA-N |
| XLogP | 11.71 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.89 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |