C36H34F2N4O7 — CID 162425151
N-[3-fluoro-4-[[5-(3-morpholin-4-ylpropoxy)-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide (PubChem CID 162425151) has the molecular formula C36H34F2N4O7 and a molecular weight of 672.69 g/mol. Its IUPAC name is N-[3-fluoro-4-[[5-(3-morpholin-4-ylpropoxy)-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[[5-(3-morpholin-4-ylpropoxy)-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 162425151 |
| Molecular Formula | C36H34F2N4O7 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | N-[3-fluoro-4-[[5-(3-morpholin-4-ylpropoxy)-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC2=CC=NC3=CC(OCCCN4CCOCC4)=C4OCCOC4C32)c(F)c1)c1cccn(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C36H34F2N4O7/c37-23-4-7-25(8-5-23)42-13-1-3-26(36(42)44)35(43)40-24-6-9-29(27(38)21-24)49-30-10-11-39-28-22-31(33-34(32(28)30)48-20-19-47-33)46-16-2-12-41-14-17-45-18-15-41/h1,3-11,13,21-22,32,34H,2,12,14-20H2,(H,40,43) |
| InChIKey | UTPIUDBJCSOSKD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|