C32H27F2N3O7 — CID 162425154
4-ethoxy-N-[3-fluoro-4-[(5-methoxy-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide (PubChem CID 162425154) has the molecular formula C32H27F2N3O7 and a molecular weight of 603.58 g/mol. Its IUPAC name is 4-ethoxy-N-[3-fluoro-4-[(5-methoxy-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 4-ethoxy-N-[3-fluoro-4-[(5-methoxy-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 162425154 |
| Molecular Formula | C32H27F2N3O7 |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 4-ethoxy-N-[3-fluoro-4-[(5-methoxy-2,3,10a,10b-tetrahydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]phenyl]-1-(4-fluorophenyl)-2-oxopyridine-3-carboxamide |
| SMILES | CCOc1ccn(-c2ccc(F)cc2)c(=O)c1C(=O)Nc1ccc(OC2=CC=NC3=CC(OC)=C4OCCOC4C32)c(F)c1 |
| InChI | InChI=1S/C32H27F2N3O7/c1-3-41-24-11-13-37(20-7-4-18(33)5-8-20)32(39)28(24)31(38)36-19-6-9-23(21(34)16-19)44-25-10-12-35-22-17-26(40-2)29-30(27(22)25)43-15-14-42-29/h4-13,16-17,27,30H,3,14-15H2,1-2H3,(H,36,38) |
| InChIKey | LHXCJPQQUQLXNV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |