About CID 162425271
CID 162425271 (PubChem CID 162425271) has the molecular formula C20H20IrNO2-
and a molecular weight of 498.60 g/mol.
Molecular Properties
| Compound Name | CID 162425271 |
| PubChem CID | 162425271 |
| Molecular Formula | C20H20IrNO2- |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.[C-]1=CC2C3C=CC1(c1ccccn1)C=CC23.[Ir] |
| InChI | InChI=1S/C15H12N.C5H8O2.Ir/c1-2-10-16-14(3-1)15-7-4-11-12(5-8-15)13(11)6-9-15;1-4(6)3-5(2)7;/h1-8,10-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | FVZWYZIUZNADSV-LWFKIUJUSA-N |
| XLogP | 3.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162425271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162425271?
The IUPAC name of CID 162425271 (CID 162425271) is not available.
What is the SMILES notation for CID 162425271?
The canonical SMILES for CID 162425271 is CC(=O)/C=C(/C)O.[C-]1=CC2C3C=CC1(c1ccccn1)C=CC23.[Ir].
What is the InChIKey of CID 162425271?
The InChIKey is FVZWYZIUZNADSV-LWFKIUJUSA-N. The full InChI is InChI=1S/C15H12N.C5H8O2.Ir/c1-2-10-16-14(3-1)15-7-4-11-12(5-8-15)13(11)6-9-15;1-4(6)3-5(2)7;/h1-8,10-13H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 162425271?
CID 162425271 has a molecular weight of 498.60 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162425271 is sourced from PubChem (CID 162425271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).