C30H30ClN3O8 — CID 162426118
4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-3-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]benzamide (PubChem CID 162426118) has the molecular formula C30H30ClN3O8 and a molecular weight of 596.04 g/mol. Its IUPAC name is 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-3-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]benzamide.
| Compound Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-3-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 162426118 |
| Molecular Formula | C30H30ClN3O8 |
| Molecular Weight | 596.04 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]-3-hydroxy-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCCO)c1ccc(-c2ccc(-c3cc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)c(O)c1 |
| InChI | InChI=1S/C30H30ClN3O8/c31-21-13-23-22(33-30(34-23)42-26-15-41-27-25(37)14-40-28(26)27)12-20(21)17-3-1-16(2-4-17)19-6-5-18(11-24(19)36)29(38)32-7-9-39-10-8-35/h1-6,11-13,25-28,35-37H,7-10,14-15H2,(H,32,38)(H,33,34)/t25-,26-,27-,28-/m1/s1 |
| InChIKey | YLKRXJXHAQUJIP-BIYDSLDMSA-N |
| XLogP | 2.90 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.04 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|