C22H17F4N3O2 — CID 162428244
N-[2-(N-acetyl-4-fluoroanilino)-4-pyridinyl]-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 162428244) has the molecular formula C22H17F4N3O2 and a molecular weight of 431.39 g/mol. Its IUPAC name is N-[2-(N-acetyl-4-fluoroanilino)-4-pyridinyl]-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-(N-acetyl-4-fluoroanilino)-4-pyridinyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 162428244 |
| Molecular Formula | C22H17F4N3O2 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[2-(N-acetyl-4-fluoroanilino)-4-pyridinyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)N(c1ccc(F)cc1)c1cc(NC(=O)Cc2ccccc2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C22H17F4N3O2/c1-14(30)29(18-8-6-16(23)7-9-18)20-13-17(10-11-27-20)28-21(31)12-15-4-2-3-5-19(15)22(24,25)26/h2-11,13H,12H2,1H3,(H,27,28,31) |
| InChIKey | KOSGTWHJVXCOBQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |