About N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide
N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide (PubChem CID 162428668) has the molecular formula C21H16N4OS
and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide |
| PubChem CID | 162428668 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide |
| SMILES | O=C(Nc1c2c(nn1-c1ccncc1)CSC2)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H16N4OS/c26-21(17-7-3-5-14-4-1-2-6-16(14)17)23-20-18-12-27-13-19(18)24-25(20)15-8-10-22-11-9-15/h1-11H,12-13H2,(H,23,26) |
| InChIKey | GVNKRMPJJSHUOI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide?
The IUPAC name of N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide (CID 162428668) is N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide.
What is the SMILES notation for N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide?
The canonical SMILES for N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide is O=C(Nc1c2c(nn1-c1ccncc1)CSC2)c1cccc2ccccc12.
What is the InChIKey of N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide?
The InChIKey is GVNKRMPJJSHUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4OS/c26-21(17-7-3-5-14-4-1-2-6-16(14)17)23-20-18-12-27-13-19(18)24-25(20)15-8-10-22-11-9-15/h1-11H,12-13H2,(H,23,26).
What are the key properties of N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide?
N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide has a molecular weight of 372.45 g/mol, XLogP of 4.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-pyridin-4-yl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)naphthalene-1-carboxamide is sourced from PubChem (CID 162428668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).