C24H25N7O2 — CID 162428884
4-N-[4-[3-(ethylideneamino)-4-methylphenoxy]-3-methylphenyl]-6-N-methoxy-6-N-methylpyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 162428884) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-N-[4-[3-(ethylideneamino)-4-methylphenoxy]-3-methylphenyl]-6-N-methoxy-6-N-methylpyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[4-[3-(ethylideneamino)-4-methylphenoxy]-3-methylphenyl]-6-N-methoxy-6-N-methylpyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 162428884 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-N-[4-[3-(ethylideneamino)-4-methylphenoxy]-3-methylphenyl]-6-N-methoxy-6-N-methylpyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | C/C=N/c1cc(Oc2ccc(Nc3ncnc4cnc(N(C)OC)nc34)cc2C)ccc1C |
| InChI | InChI=1S/C24H25N7O2/c1-6-25-19-12-18(9-7-15(19)2)33-21-10-8-17(11-16(21)3)29-23-22-20(27-14-28-23)13-26-24(30-22)31(4)32-5/h6-14H,1-5H3,(H,27,28,29)/b25-6+ |
| InChIKey | RYGUUSSFVNEUAO-KXEZBXAJSA-N |
| XLogP | 5.29 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|