About benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate
benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate (PubChem CID 162429099) has the molecular formula C19H21F2NO2
and a molecular weight of 333.38 g/mol. Its IUPAC name is benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate |
| PubChem CID | 162429099 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate |
| SMILES | C[C@@H]([NH2+]Cc1ccccc1)c1ccccc1.O=C([O-])[C@@H]1CC1(F)F |
| InChI | InChI=1S/C15H17N.C4H4F2O2/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14;5-4(6)1-2(4)3(7)8/h2-11,13,16H,12H2,1H3;2H,1H2,(H,7,8)/t13-;2-/m10/s1 |
| InChIKey | LGXRAFNCRJIHBG-KQZRFNQSSA-N |
| XLogP | 1.90 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate?
The IUPAC name of benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate (CID 162429099) is benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate.
What is the SMILES notation for benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate?
The canonical SMILES for benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate is C[C@@H]([NH2+]Cc1ccccc1)c1ccccc1.O=C([O-])[C@@H]1CC1(F)F.
What is the InChIKey of benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate?
The InChIKey is LGXRAFNCRJIHBG-KQZRFNQSSA-N. The full InChI is InChI=1S/C15H17N.C4H4F2O2/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14;5-4(6)1-2(4)3(7)8/h2-11,13,16H,12H2,1H3;2H,1H2,(H,7,8)/t13-;2-/m10/s1.
What are the key properties of benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate?
benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate has a molecular weight of 333.38 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(1R)-1-phenylethyl]azanium;(1S)-2,2-difluorocyclopropane-1-carboxylate is sourced from PubChem (CID 162429099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).