C13H18O2 — CID 162429943
(4E,6E)-4-methyl-7-prop-2-enoxynona-4,6,8-trienal (PubChem CID 162429943) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (4E,6E)-4-methyl-7-prop-2-enoxynona-4,6,8-trienal.
| Compound Name | (4E,6E)-4-methyl-7-prop-2-enoxynona-4,6,8-trienal |
|---|---|
| PubChem CID | 162429943 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4E,6E)-4-methyl-7-prop-2-enoxynona-4,6,8-trienal |
| SMILES | C=CCO/C(C=C)=C/C=C(\C)CCC=O |
| InChI | InChI=1S/C13H18O2/c1-4-11-15-13(5-2)9-8-12(3)7-6-10-14/h4-5,8-10H,1-2,6-7,11H2,3H3/b12-8+,13-9+ |
| InChIKey | GRVBIEHQMJTFOU-QHKWOANTSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|