C20H23ClFNO — CID 162430562
[1-[(4-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]methanol (PubChem CID 162430562) has the molecular formula C20H23ClFNO and a molecular weight of 347.86 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[(4-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 162430562 |
| Molecular Formula | C20H23ClFNO |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]methanol |
| SMILES | OCC1(CCc2ccc(F)cc2)CCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H23ClFNO/c21-18-5-1-17(2-6-18)13-23-12-11-20(14-23,15-24)10-9-16-3-7-19(22)8-4-16/h1-8,24H,9-15H2 |
| InChIKey | CTNQEPFOFFRHBF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |