C15H17BrN2O2 — CID 162431050
6-bromo-1'-ethyl-8-methylspiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione (PubChem CID 162431050) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 6-bromo-1'-ethyl-8-methylspiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione.
| Compound Name | 6-bromo-1'-ethyl-8-methylspiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione |
|---|---|
| PubChem CID | 162431050 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 6-bromo-1'-ethyl-8-methylspiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione |
| SMILES | CCC1=CC2(CCC1)NC(=O)c1c(C)cc(Br)c(=O)n12 |
| InChI | InChI=1S/C15H17BrN2O2/c1-3-10-5-4-6-15(8-10)17-13(19)12-9(2)7-11(16)14(20)18(12)15/h7-8H,3-6H2,1-2H3,(H,17,19) |
| InChIKey | YPPATQZJRJWPSB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|