C22H21N5S — CID 162431123
6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazol-2-amine (PubChem CID 162431123) has the molecular formula C22H21N5S and a molecular weight of 387.51 g/mol. Its IUPAC name is 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162431123 |
| Molecular Formula | C22H21N5S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc([C@@H]3Nc4ccc5[nH]ncc5c4[C@H]4C5CCC(C5)[C@@H]34)cc2s1 |
| InChI | InChI=1S/C22H21N5S/c23-22-26-15-4-3-12(8-17(15)28-22)21-19-11-2-1-10(7-11)18(19)20-13-9-24-27-14(13)5-6-16(20)25-21/h3-6,8-11,18-19,21,25H,1-2,7H2,(H2,23,26)(H,24,27)/t10?,11?,18-,19+,21-/m0/s1 |
| InChIKey | UZYTZGAWBDOABT-OQUGKTIRSA-N |
| XLogP | 5.05 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |