C25H23N5O2S — CID 162431222
4-[(7R,8S,9R)-7-(2-amino-1,3-benzothiazol-6-yl)-8-methyl-6,7,8,9-tetrahydro-3H-pyrazolo[4,5-f]quinolin-9-yl]-2-methoxyphenol (PubChem CID 162431222) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-[(7R,8S,9R)-7-(2-amino-1,3-benzothiazol-6-yl)-8-methyl-6,7,8,9-tetrahydro-3H-pyrazolo[4,5-f]quinolin-9-yl]-2-methoxyphenol.
| Compound Name | 4-[(7R,8S,9R)-7-(2-amino-1,3-benzothiazol-6-yl)-8-methyl-6,7,8,9-tetrahydro-3H-pyrazolo[4,5-f]quinolin-9-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 162431222 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-[(7R,8S,9R)-7-(2-amino-1,3-benzothiazol-6-yl)-8-methyl-6,7,8,9-tetrahydro-3H-pyrazolo[4,5-f]quinolin-9-yl]-2-methoxyphenol |
| SMILES | COc1cc([C@@H]2c3c(ccc4[nH]ncc34)N[C@@H](c3ccc4nc(N)sc4c3)[C@H]2C)ccc1O |
| InChI | InChI=1S/C25H23N5O2S/c1-12-22(13-4-8-19(31)20(9-13)32-2)23-15-11-27-30-16(15)6-7-18(23)28-24(12)14-3-5-17-21(10-14)33-25(26)29-17/h3-12,22,24,28,31H,1-2H3,(H2,26,29)(H,27,30)/t12-,22+,24+/m0/s1 |
| InChIKey | KWUOKDMGQVZGRQ-ZHSKTPGZSA-N |
| XLogP | 5.40 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |