C20H19N5OS — CID 162431286
6-[(7S,8R)-3-oxa-9,14,15-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13(17),15-tetraen-8-yl]-1,3-benzothiazol-2-amine (PubChem CID 162431286) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is 6-[(7S,8R)-3-oxa-9,14,15-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13(17),15-tetraen-8-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(7S,8R)-3-oxa-9,14,15-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13(17),15-tetraen-8-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162431286 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 6-[(7S,8R)-3-oxa-9,14,15-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),11,13(17),15-tetraen-8-yl]-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc([C@@H]3Nc4ccc5[nH]ncc5c4C4OCCC[C@H]43)cc2s1 |
| InChI | InChI=1S/C20H19N5OS/c21-20-24-14-4-3-10(8-16(14)27-20)18-11-2-1-7-26-19(11)17-12-9-22-25-13(12)5-6-15(17)23-18/h3-6,8-9,11,18-19,23H,1-2,7H2,(H2,21,24)(H,22,25)/t11-,18-,19?/m0/s1 |
| InChIKey | VSPMMIWJLPLAAQ-HZFKLFMYSA-N |
| XLogP | 4.39 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |