C6H11F3N2 — CID 162431356
ethane;(Z)-1,1,1-trifluoro-4-iminobut-2-en-2-amine (PubChem CID 162431356) has the molecular formula C6H11F3N2 and a molecular weight of 168.16 g/mol. Its IUPAC name is ethane;(Z)-1,1,1-trifluoro-4-iminobut-2-en-2-amine.
| Compound Name | ethane;(Z)-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 162431356 |
| Molecular Formula | C6H11F3N2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | ethane;(Z)-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
| SMILES | CC.[H]/N=C/C=C(\N)C(F)(F)F |
| InChI | InChI=1S/C4H5F3N2.C2H6/c5-4(6,7)3(9)1-2-8;1-2/h1-2,8H,9H2;1-2H3/b3-1-,8-2+; |
| InChIKey | ZUSRWYYQBQUHBT-SWBDCZCJSA-N |
| XLogP | 2.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|