C32H35N7O3Si — CID 162431814
5-[tert-butyl(dimethyl)silyl]oxy-N-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]pent-2-ynamide (PubChem CID 162431814) has the molecular formula C32H35N7O3Si and a molecular weight of 593.76 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-N-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]pent-2-ynamide.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-N-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]pent-2-ynamide |
|---|---|
| PubChem CID | 162431814 |
| Molecular Formula | C32H35N7O3Si |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-N-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]pent-2-ynamide |
| SMILES | Cc1cc(Nc2ncnc3ccc(NC(=O)C#CCCO[Si](C)(C)C(C)(C)C)cc23)ccc1Oc1ccn2ncnc2c1 |
| InChI | InChI=1S/C32H35N7O3Si/c1-22-17-23(11-13-28(22)42-25-14-15-39-29(19-25)34-21-36-39)38-31-26-18-24(10-12-27(26)33-20-35-31)37-30(40)9-7-8-16-41-43(5,6)32(2,3)4/h10-15,17-21H,8,16H2,1-6H3,(H,37,40)(H,33,35,38) |
| InChIKey | SPGRHRUYTFRCEH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|