C24H45FN4O2 — CID 162432814
2-butylhexyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 162432814) has the molecular formula C24H45FN4O2 and a molecular weight of 440.65 g/mol. Its IUPAC name is 2-butylhexyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 2-butylhexyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 162432814 |
| Molecular Formula | C24H45FN4O2 |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 2-butylhexyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCCCC(CCCC)COC(=O)C1CC2C[C@@](F)(CC/C(N)=N/NC)CCC2CN1 |
| InChI | InChI=1S/C24H45FN4O2/c1-4-6-8-18(9-7-5-2)17-31-23(30)21-14-20-15-24(25,12-10-19(20)16-28-21)13-11-22(26)29-27-3/h18-21,27-28H,4-17H2,1-3H3,(H2,26,29)/t19?,20?,21?,24-/m0/s1 |
| InChIKey | KCFPJWRSMVFUCG-HFHBMHTISA-N |
| XLogP | 4.28 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|