C23H43FN4O2 — CID 162432823
nonyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 162432823) has the molecular formula C23H43FN4O2 and a molecular weight of 426.62 g/mol. Its IUPAC name is nonyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | nonyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 162432823 |
| Molecular Formula | C23H43FN4O2 |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.34 |
| IUPAC Name | nonyl (6S)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CC2C[C@@](F)(CC/C(N)=N/NC)CCC2CN1 |
| InChI | InChI=1S/C23H43FN4O2/c1-3-4-5-6-7-8-9-14-30-22(29)20-15-19-16-23(24,12-10-18(19)17-27-20)13-11-21(25)28-26-2/h18-20,26-27H,3-17H2,1-2H3,(H2,25,28)/t18?,19?,20?,23-/m0/s1 |
| InChIKey | DPOWOFLVSADDIQ-ZNHUPSQZSA-N |
| XLogP | 4.04 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|