C20H36F2N4O2 — CID 162432825
heptan-4-yl (6S)-8a-amino-6-[(3Z)-3-amino-3-fluoroiminopropyl]-6-fluoro-1,2,3,4,4a,5,7,8-octahydroisoquinoline-3-carboxylate (PubChem CID 162432825) has the molecular formula C20H36F2N4O2 and a molecular weight of 402.53 g/mol. Its IUPAC name is heptan-4-yl (6S)-8a-amino-6-[(3Z)-3-amino-3-fluoroiminopropyl]-6-fluoro-1,2,3,4,4a,5,7,8-octahydroisoquinoline-3-carboxylate.
| Compound Name | heptan-4-yl (6S)-8a-amino-6-[(3Z)-3-amino-3-fluoroiminopropyl]-6-fluoro-1,2,3,4,4a,5,7,8-octahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 162432825 |
| Molecular Formula | C20H36F2N4O2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | heptan-4-yl (6S)-8a-amino-6-[(3Z)-3-amino-3-fluoroiminopropyl]-6-fluoro-1,2,3,4,4a,5,7,8-octahydroisoquinoline-3-carboxylate |
| SMILES | CCCC(CCC)OC(=O)C1CC2C[C@@](F)(CC/C(N)=N/F)CCC2(N)CN1 |
| InChI | InChI=1S/C20H36F2N4O2/c1-3-5-15(6-4-2)28-18(27)16-11-14-12-19(21,8-7-17(23)26-22)9-10-20(14,24)13-25-16/h14-16,25H,3-13,24H2,1-2H3,(H2,23,26)/t14?,16?,19-,20?/m1/s1 |
| InChIKey | CAOSJKLABJKLMA-HPXPDKBJSA-N |
| XLogP | 3.09 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|