C16H27FN2O2 — CID 162432828
ethyl (6S)-6-fluoro-6-(3-iminobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 162432828) has the molecular formula C16H27FN2O2 and a molecular weight of 298.40 g/mol. Its IUPAC name is ethyl (6S)-6-fluoro-6-(3-iminobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | ethyl (6S)-6-fluoro-6-(3-iminobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 162432828 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | ethyl (6S)-6-fluoro-6-(3-iminobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | [H]/N=C(\C)CC[C@@]1(F)CCC2CNC(C(=O)OCC)CC2C1 |
| InChI | InChI=1S/C16H27FN2O2/c1-3-21-15(20)14-8-13-9-16(17,6-4-11(2)18)7-5-12(13)10-19-14/h12-14,18-19H,3-10H2,1-2H3/b18-11+/t12?,13?,14?,16-/m1/s1 |
| InChIKey | AWJVORZRXSSTFW-IFVSWPSWSA-N |
| XLogP | 2.86 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|