C21H38FN5O4 — CID 162432842
2-O-tert-butyl 3-O-ethyl (3S)-6-fluoro-6-[(3Z)-3-hydrazinylidene-3-(2-methylhydrazinyl)propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate (PubChem CID 162432842) has the molecular formula C21H38FN5O4 and a molecular weight of 443.56 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl (3S)-6-fluoro-6-[(3Z)-3-hydrazinylidene-3-(2-methylhydrazinyl)propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl (3S)-6-fluoro-6-[(3Z)-3-hydrazinylidene-3-(2-methylhydrazinyl)propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 162432842 |
| Molecular Formula | C21H38FN5O4 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl (3S)-6-fluoro-6-[(3Z)-3-hydrazinylidene-3-(2-methylhydrazinyl)propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2CC(F)(CC/C(=N/N)NNC)CCC2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38FN5O4/c1-6-30-18(28)16-11-15-12-21(22,10-8-17(25-23)26-24-5)9-7-14(15)13-27(16)19(29)31-20(2,3)4/h14-16,24H,6-13,23H2,1-5H3,(H,25,26)/t14?,15?,16-,21?/m0/s1 |
| InChIKey | FTGTUQCOYKXQAY-SAAHUIRJSA-N |
| XLogP | 2.46 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|