About ethane;2,5,7-trimethylindazol-6-ol
ethane;2,5,7-trimethylindazol-6-ol (PubChem CID 162433004) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is ethane;2,5,7-trimethylindazol-6-ol.
Molecular Properties
| Compound Name | ethane;2,5,7-trimethylindazol-6-ol |
| PubChem CID | 162433004 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | ethane;2,5,7-trimethylindazol-6-ol |
| SMILES | CC.Cc1cc2cn(C)nc2c(C)c1O |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-6-4-8-5-12(3)11-9(8)7(2)10(6)13;1-2/h4-5,13H,1-3H3;1-2H3 |
| InChIKey | FMALSAHNMFKBSH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2,5,7-trimethylindazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,5,7-trimethylindazol-6-ol?
The IUPAC name of ethane;2,5,7-trimethylindazol-6-ol (CID 162433004) is ethane;2,5,7-trimethylindazol-6-ol.
What is the SMILES notation for ethane;2,5,7-trimethylindazol-6-ol?
The canonical SMILES for ethane;2,5,7-trimethylindazol-6-ol is CC.Cc1cc2cn(C)nc2c(C)c1O.
What is the InChIKey of ethane;2,5,7-trimethylindazol-6-ol?
The InChIKey is FMALSAHNMFKBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.C2H6/c1-6-4-8-5-12(3)11-9(8)7(2)10(6)13;1-2/h4-5,13H,1-3H3;1-2H3.
What are the key properties of ethane;2,5,7-trimethylindazol-6-ol?
ethane;2,5,7-trimethylindazol-6-ol has a molecular weight of 206.29 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,5,7-trimethylindazol-6-ol is sourced from PubChem (CID 162433004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).