About 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole
5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole (PubChem CID 162433217) has the molecular formula C19H20FN5OS
and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole.
Molecular Properties
| Compound Name | 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole |
| PubChem CID | 162433217 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole |
| SMILES | COc1c(-c2cc3cn(C4CCNCC4)nc3s2)cc2cn(C)nc2c1F |
| InChI | InChI=1S/C19H20FN5OS/c1-24-9-11-7-14(18(26-2)16(20)17(11)22-24)15-8-12-10-25(23-19(12)27-15)13-3-5-21-6-4-13/h7-10,13,21H,3-6H2,1-2H3 |
| InChIKey | DIZUDKRKPQIDOM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole?
The IUPAC name of 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole (CID 162433217) is 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole.
What is the SMILES notation for 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole?
The canonical SMILES for 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole is COc1c(-c2cc3cn(C4CCNCC4)nc3s2)cc2cn(C)nc2c1F.
What is the InChIKey of 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole?
The InChIKey is DIZUDKRKPQIDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN5OS/c1-24-9-11-7-14(18(26-2)16(20)17(11)22-24)15-8-12-10-25(23-19(12)27-15)13-3-5-21-6-4-13/h7-10,13,21H,3-6H2,1-2H3.
What are the key properties of 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole?
5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole has a molecular weight of 385.47 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-fluoro-6-methoxy-2-methylindazol-5-yl)-2-piperidin-4-ylthieno[2,3-c]pyrazole is sourced from PubChem (CID 162433217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).