C24H30N6OS — CID 162433231
2-[2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]imidazo[2,1-b][1,3]thiazol-6-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 162433231) has the molecular formula C24H30N6OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-[2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]imidazo[2,1-b][1,3]thiazol-6-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]imidazo[2,1-b][1,3]thiazol-6-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 162433231 |
| Molecular Formula | C24H30N6OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]imidazo[2,1-b][1,3]thiazol-6-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | CN(c1cn2cc(-c3ccc(-c4cn[nH]c4)cc3O)nc2s1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H30N6OS/c1-23(2)9-17(10-24(3,4)28-23)29(5)21-14-30-13-19(27-22(30)32-21)18-7-6-15(8-20(18)31)16-11-25-26-12-16/h6-8,11-14,17,28,31H,9-10H2,1-5H3,(H,25,26) |
| InChIKey | BWZZXDXCPDKWGP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |