C9H16N2 — CID 162433340
2-methyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazine (PubChem CID 162433340) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-methyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 162433340 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-methyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazine |
| SMILES | CN1CCN2C=CCCC2C1 |
| InChI | InChI=1S/C9H16N2/c1-10-6-7-11-5-3-2-4-9(11)8-10/h3,5,9H,2,4,6-8H2,1H3 |
| InChIKey | AXJKNIPGOUOSNR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |