C11H12ClFN2 — CID 162434263
8-chloro-7-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 162434263) has the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. Its IUPAC name is 8-chloro-7-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | 8-chloro-7-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 162434263 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 8-chloro-7-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | Fc1cc2c(cc1Cl)CC1CNCCN21 |
| InChI | InChI=1S/C11H12ClFN2/c12-9-4-7-3-8-6-14-1-2-15(8)11(7)5-10(9)13/h4-5,8,14H,1-3,6H2 |
| InChIKey | SQSBJIMMBYDOBS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |