C11H12Cl2N2 — CID 162434303
7,8-dichloro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 162434303) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is 7,8-dichloro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | 7,8-dichloro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 162434303 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 7,8-dichloro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | Clc1cc2c(cc1Cl)N1CCNCC1C2 |
| InChI | InChI=1S/C11H12Cl2N2/c12-9-4-7-3-8-6-14-1-2-15(8)11(7)5-10(9)13/h4-5,8,14H,1-3,6H2 |
| InChIKey | KWTYPRMSUXIRRH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |