C11H5ClF5NO2 — CID 162436057
1-(3-chloro-7-hydroxy-5H-cyclopenta[c]pyridin-6-yl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 162436057) has the molecular formula C11H5ClF5NO2 and a molecular weight of 313.61 g/mol. Its IUPAC name is 1-(3-chloro-7-hydroxy-5H-cyclopenta[c]pyridin-6-yl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(3-chloro-7-hydroxy-5H-cyclopenta[c]pyridin-6-yl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 162436057 |
| Molecular Formula | C11H5ClF5NO2 |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 1-(3-chloro-7-hydroxy-5H-cyclopenta[c]pyridin-6-yl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | O=C(C1=C(O)c2cnc(Cl)cc2C1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5ClF5NO2/c12-7-2-4-1-5(8(19)6(4)3-18-7)9(20)10(13,14)11(15,16)17/h2-3,19H,1H2 |
| InChIKey | PNXRUZCFNYAHEW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|