C34H47ClNORu-2 — CID 162436243
carbanide;chloro-[(2-propoxyphenyl)methylidene]ruthenium;(4S)-1-(2,6-diethylcyclohexa-1,5-dien-1-yl)-2,2,4-trimethyl-4-phenylpyrrolidin-5-ide (PubChem CID 162436243) has the molecular formula C34H47ClNORu-2 and a molecular weight of 622.28 g/mol. Its IUPAC name is carbanide;chloro-[(2-propoxyphenyl)methylidene]ruthenium;(4S)-1-(2,6-diethylcyclohexa-1,5-dien-1-yl)-2,2,4-trimethyl-4-phenylpyrrolidin-5-ide.
| Compound Name | carbanide;chloro-[(2-propoxyphenyl)methylidene]ruthenium;(4S)-1-(2,6-diethylcyclohexa-1,5-dien-1-yl)-2,2,4-trimethyl-4-phenylpyrrolidin-5-ide |
|---|---|
| PubChem CID | 162436243 |
| Molecular Formula | C34H47ClNORu-2 |
| Molecular Weight | 622.28 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | carbanide;chloro-[(2-propoxyphenyl)methylidene]ruthenium;(4S)-1-(2,6-diethylcyclohexa-1,5-dien-1-yl)-2,2,4-trimethyl-4-phenylpyrrolidin-5-ide |
| SMILES | CCC1=CCCC(CC)=C1N1[CH-][C@](C)(c2ccccc2)CC1(C)C.CCCOc1ccccc1/C=[Ru]\Cl.[CH3-] |
| InChI | InChI=1S/C23H32N.C10H12O.CH3.ClH.Ru/c1-6-18-12-11-13-19(7-2)21(18)24-17-23(5,16-22(24,3)4)20-14-9-8-10-15-20;1-3-8-11-10-7-5-4-6-9(10)2;;;/h8-10,12,14-15,17H,6-7,11,13,16H2,1-5H3;2,4-7H,3,8H2,1H3;1H3;1H;/q-1;;-1;;+1/p-1/t23-;;;;/m1..../s1 |
| InChIKey | RHBTXLYODDBTIP-SKROYXCESA-M |
| XLogP | 9.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.28 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|