C30H52 — CID 162436805
1,5-diethyl-3-[(6E)-8-ethyl-4,7,8,12-tetramethyl-3-methylidenetrideca-6,11-dienyl]cyclohexene (PubChem CID 162436805) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is 1,5-diethyl-3-[(6E)-8-ethyl-4,7,8,12-tetramethyl-3-methylidenetrideca-6,11-dienyl]cyclohexene.
| Compound Name | 1,5-diethyl-3-[(6E)-8-ethyl-4,7,8,12-tetramethyl-3-methylidenetrideca-6,11-dienyl]cyclohexene |
|---|---|
| PubChem CID | 162436805 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | 1,5-diethyl-3-[(6E)-8-ethyl-4,7,8,12-tetramethyl-3-methylidenetrideca-6,11-dienyl]cyclohexene |
| SMILES | C=C(CCC1C=C(CC)CC(CC)C1)C(C)C/C=C(\C)C(C)(CC)CCC=C(C)C |
| InChI | InChI=1S/C30H52/c1-10-27-20-28(11-2)22-29(21-27)18-16-25(7)24(6)15-17-26(8)30(9,12-3)19-13-14-23(4)5/h14,17,21,24,28-29H,7,10-13,15-16,18-20,22H2,1-6,8-9H3/b26-17+ |
| InChIKey | KISQAOADHNMQIC-YZSQISJMSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|