About 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+)
3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) (PubChem CID 162437231) has the molecular formula C9H8BrF3NOOs
and a molecular weight of 473.30 g/mol. Its IUPAC name is 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+).
Molecular Properties
| Compound Name | 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) |
| PubChem CID | 162437231 |
| Molecular Formula | C9H8BrF3NOOs |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) |
| SMILES | Cc1ccn(C[CH-]C(F)(F)F)c(=O)c1Br.[Os+] |
| InChI | InChI=1S/C9H8BrF3NO.Os/c1-6-2-4-14(8(15)7(6)10)5-3-9(11,12)13;/h2-4H,5H2,1H3;/q-1;+1 |
| InChIKey | PGMPMYKSTZJFBF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+)?
The IUPAC name of 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) (CID 162437231) is 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+).
What is the SMILES notation for 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+)?
The canonical SMILES for 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) is Cc1ccn(C[CH-]C(F)(F)F)c(=O)c1Br.[Os+].
What is the InChIKey of 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+)?
The InChIKey is PGMPMYKSTZJFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3NO.Os/c1-6-2-4-14(8(15)7(6)10)5-3-9(11,12)13;/h2-4H,5H2,1H3;/q-1;+1.
What are the key properties of 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+)?
3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) has a molecular weight of 473.30 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methyl-1-(3,3,3-trifluoropropyl)pyridin-2-one;osmium(1+) is sourced from PubChem (CID 162437231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).