C8H10F3NO2 — CID 162437268
N-[(1Z,3Z)-7,7,7-trifluoro-6-hydroxyhepta-1,3-dienyl]formamide (PubChem CID 162437268) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is N-[(1Z,3Z)-7,7,7-trifluoro-6-hydroxyhepta-1,3-dienyl]formamide.
| Compound Name | N-[(1Z,3Z)-7,7,7-trifluoro-6-hydroxyhepta-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 162437268 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-[(1Z,3Z)-7,7,7-trifluoro-6-hydroxyhepta-1,3-dienyl]formamide |
| SMILES | O=CN/C=C\C=C/CC(O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c9-8(10,11)7(14)4-2-1-3-5-12-6-13/h1-3,5-7,14H,4H2,(H,12,13)/b2-1-,5-3- |
| InChIKey | OHTTXPGKDWTDQB-NWJCXACMSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|